EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30461 - orthotelluric acid
| Formula | H6O6Te |
| Net Charge | 0 |
| Average Mass | 229.642 |
| Monoisotopic Mass | 231.92266 |
| SMILES | [H]O[Te](O[H])(O[H])(O[H])(O[H])O[H] |
| InChI | InChI=1S/H6O6Te/c1-7(2,3,4,5)6/h1-6H |
| InChIKey | FXADMRZICBQPQY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orthotelluric acid (CHEBI:30461) is a tellurium oxoacid (CHEBI:33519) |
| orthotelluric acid (CHEBI:30461) is conjugate acid of orthotellurate(1−) (CHEBI:36293) |
| Incoming Relation(s) |
| orthotellurate(1−) (CHEBI:36293) is conjugate base of orthotelluric acid (CHEBI:30461) |
| IUPAC Names |
|---|
| hexahydroxidotellurium |
| orthotelluric acid |
| Synonyms | Source |
|---|---|
| H6TeO6 | IUPAC |
| Orthotellursäure | ChEBI |
| telluric(VI) acid | ChemIDplus |
| tellurium hydroxide | ChemIDplus |
| [Te(OH)6] | IUPAC |