EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@@H](O)O[C@@H]2CO)[C@@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a1122h-1a_1-5][a1122h-1b_1-5]/1-2/a4-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8+,9+,10-,11+,12+/m1/s1 |
| InChIKey | GUBGYTABKSRVRQ-TYAPZPMWSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-mannobiose (CHEBI:36224) is a mannobiose (CHEBI:25164) |
| Incoming Relation(s) |
| α-D-Man3Me-(1→4)-α-D-Man3Me (CHEBI:145745) has functional parent α-mannobiose (CHEBI:36224) |
| 1,3,3'-tri-O-methyl-4α-mannobiose (CHEBI:145746) is a α-mannobiose (CHEBI:36224) |
| IUPAC Name |
|---|
| β-D-mannopyranosyl-(1→4)-α-D-mannopyranose |
| Synonym | Source |
|---|---|
| 4-O-β-D-mannopyranosyl-α-D-mannopyranose | IUPAC |