EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O11 |
| Net Charge | 0 |
| Average Mass | 384.378 |
| Monoisotopic Mass | 384.16316 |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](OC)[C@@H]2O)[C@H](OC)[C@@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a1122h-1a_1-5_1*OC_3*OC][a1122h-1b_1-5_3*OC]/1-2/a4-b1 |
| InChI | InChI=1S/C15H28O11/c1-21-12-8(18)6(4-16)24-15(9(12)19)26-11-7(5-17)25-14(23-3)10(20)13(11)22-2/h6-20H,4-5H2,1-3H3/t6-,7-,8-,9+,10+,11-,12+,13-,14+,15+/m1/s1 |
| InChIKey | GJVGVCRJQPOURF-AAYHEAFJSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,3'-tri-O-methyl-4α-mannobiose (CHEBI:145746) is a α-mannobiose (CHEBI:36224) |
| UniProt Name | Source |
|---|---|
| 1,3,3'-tri-O-methyl-4α-mannobiose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-22679 | MetaCyc |
| Citations |
|---|