EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O2 |
| Net Charge | 0 |
| Average Mass | 306.490 |
| Monoisotopic Mass | 306.25588 |
| SMILES | CCCCC/C=C\CCCC/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,12-13,15-16H,2-5,8-11,14,17-19H2,1H3,(H,21,22)/b7-6-,13-12-,16-15- |
| InChIKey | MZHLWKPZCXLYSL-IJJPYCETSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-cis-icosa-5,8,14-trienoic acid (CHEBI:36202) is a fatty acid 20:3 (CHEBI:36036) |
| Incoming Relation(s) |
| (10R)-hydroxy-(11S,12S)-epoxyicosa-(5Z,8Z,14Z)-trienoic acid (CHEBI:75696) has functional parent all-cis-icosa-5,8,14-trienoic acid (CHEBI:36202) |
| hepoxilin B3 (CHEBI:34784) has functional parent all-cis-icosa-5,8,14-trienoic acid (CHEBI:36202) |
| trioxilin B3 (CHEBI:35032) has functional parent all-cis-icosa-5,8,14-trienoic acid (CHEBI:36202) |
| IUPAC Name |
|---|
| (5Z,8Z,14Z)-icosa-5,8,14-trienoic acid |
| Synonyms | Source |
|---|---|
| eicosa-5Z,8Z,14Z-trienoic acid | ChEBI |
| C20:3, n-6,12,15 all-cis | ChEBI |
| 5c,8c,14c-Eicosatriensäure | ChEBI |
| all-cis-Eicosa-5,8,14-triensäure | ChEBI |
| 20:3, n-6,12,15 all-cis | ChEBI |
| cis,cis,cis-5,8,14-eicosatrienoic acid | ChEBI |