EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC/C=C\C[C@@H]1O[C@H]1C(O)/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-9-12-15-18-20(24-18)17(21)14-11-8-6-7-10-13-16-19(22)23/h6-7,9,11-12,14,17-18,20-21H,2-5,8,10,13,15-16H2,1H3,(H,22,23)/b7-6-,12-9-,14-11-/t17?,18-,20-/m0/s1 |
| InChIKey | DWNBPRRXEVJMPO-RNGYDEEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cottoniella filamentosa (WORMS:144741) | - | PubMed (2180942) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10692117) | |
| Mus musculus (ncbitaxon:10090) | |||
| bronchoalveolar lavage (BTO:0000155) | MetaboLights (MTBLS34) | ||
| bronchoalveolar lavage (BTO:0000155) | MetaboLights (MTBLS31) | ||
| - | MetaboLights (MTBLS33) | ||
| - | MetaboLights (MTBLS32) | ||
| Platysiphonia miniata (WORMS:144776) | - | PubMed (2180942) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hepoxilin B3 (CHEBI:34784) has functional parent all-cis-icosa-5,8,14-trienoic acid (CHEBI:36202) |
| hepoxilin B3 (CHEBI:34784) has role algal metabolite (CHEBI:84735) |
| hepoxilin B3 (CHEBI:34784) has role human xenobiotic metabolite (CHEBI:76967) |
| hepoxilin B3 (CHEBI:34784) is a epoxy fatty acid (CHEBI:61498) |
| hepoxilin B3 (CHEBI:34784) is a hepoxilin (CHEBI:36200) |
| hepoxilin B3 (CHEBI:34784) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| hepoxilin B3 (CHEBI:34784) is a long-chain fatty acid (CHEBI:15904) |
| hepoxilin B3 (CHEBI:34784) is a trienoic fatty acid (CHEBI:73155) |
| hepoxilin B3 (CHEBI:34784) is conjugate acid of hepoxilin B3(1−) (CHEBI:78084) |
| Incoming Relation(s) |
| hepoxilin B3(1−) (CHEBI:78084) is conjugate base of hepoxilin B3 (CHEBI:34784) |
| IUPAC Name |
|---|
| (5Z,8Z)-10-hydroxy-10-{(2S,3S)-3-[(2Z)-oct-2-en-1-yl]oxiran-2-yl}deca-5,8-dienoic acid |
| Synonyms | Source |
|---|---|
| 10-hydroxy-11S,12S-epoxy-5Z,8Z,14Z-eicosatrienoic acid | LIPID MAPS |
| Hepoxilin B3 | KEGG COMPOUND |
| HxB3 | ChEBI |
| HXB3 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14810 | KEGG COMPOUND |
| LMFA03090003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:71799-95-6 | ChemIDplus |
| Citations |
|---|