EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12ClNO3S |
| Net Charge | 0 |
| Average Mass | 273.741 |
| Monoisotopic Mass | 273.02264 |
| SMILES | CN1C(=O)CCS(=O)(=O)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClNO3S/c1-13-10(14)6-7-17(15,16)11(13)8-2-4-9(12)5-3-8/h2-5,11H,6-7H2,1H3 |
| InChIKey | WEQAYVWKMWHEJO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlormezanone (CHEBI:3619) has role antipsychotic agent (CHEBI:35476) |
| chlormezanone (CHEBI:3619) has role anxiolytic drug (CHEBI:35474) |
| chlormezanone (CHEBI:3619) has role muscle relaxant (CHEBI:51371) |
| chlormezanone (CHEBI:3619) is a 1,3-thiazine (CHEBI:46975) |
| chlormezanone (CHEBI:3619) is a lactam (CHEBI:24995) |
| chlormezanone (CHEBI:3619) is a monochlorobenzenes (CHEBI:83403) |
| chlormezanone (CHEBI:3619) is a sulfone (CHEBI:35850) |
| Incoming Relation(s) |
| (R)-chlormezanone (CHEBI:59467) is a chlormezanone (CHEBI:3619) |
| (S)-chlormezanone (CHEBI:59468) is a chlormezanone (CHEBI:3619) |
| IUPAC Name |
|---|
| 2-(4-chlorophenyl)-3-methyl-1,3-thiazinan-4-one 1,1-dioxide |
| INNs | Source |
|---|---|
| chlormezanona | ChemIDplus |
| chlormezanone | ChemIDplus |
| chlormézanone | WHO MedNet |
| chlormezanonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(p-chlorophenyl)tetrahydro-3-methyl-4H-1,3-thiazin-4-one 1,1-dioxide | ChemIDplus |
| 2-(p-chlorphenyl)-3-methyl-1,3-perhydrothiazin-4-on-1,1-dioxide | ChemIDplus |
| chlormethazanone | ChemIDplus |
| (±)-chlormezanone | ChemIDplus |
| Citations |
|---|