EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36148 - 4-hydroxy-2-oxoglutarate(1−)
| Formula | H.C5H4O6 |
| Net Charge | -1 |
| Average Mass | 161.089 |
| Monoisotopic Mass | 161.00916 |
| SMILES | O=C([O-])C(=O)CC(O)C(=O)[O-].[H+] |
| InChI | InChI=1S/C5H6O6/c6-2(4(8)9)1-3(7)5(10)11/h2,6H,1H2,(H,8,9)(H,10,11)/p-1 |
| InChIKey | WXSKVKPSMAHCSG-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2-oxoglutarate(1−) (CHEBI:36148) has functional parent glutarate(1−) (CHEBI:35907) |
| 4-hydroxy-2-oxoglutarate(1−) (CHEBI:36148) is a dicarboxylic acid monoanion (CHEBI:35695) |
| 4-hydroxy-2-oxoglutarate(1−) (CHEBI:36148) is conjugate acid of 4-hydroxy-2-oxoglutarate(2−) (CHEBI:17742) |
| 4-hydroxy-2-oxoglutarate(1−) (CHEBI:36148) is conjugate base of 4-hydroxy-2-oxoglutaric acid (CHEBI:30923) |
| Incoming Relation(s) |
| 4-hydroxy-2-oxoglutaric acid (CHEBI:30923) is conjugate acid of 4-hydroxy-2-oxoglutarate(1−) (CHEBI:36148) |
| 4-hydroxy-2-oxoglutarate(2−) (CHEBI:17742) is conjugate base of 4-hydroxy-2-oxoglutarate(1−) (CHEBI:36148) |
| IUPAC Name |
|---|
| hydrogen 2-hydroxy-4-oxopentanedioate |
| Synonyms | Source |
|---|---|
| 2-keto-4-hydroxyglutarate(1−) | ChEBI |
| 2-oxo-4-hydroxyglutarate(1−) | ChEBI |
| 4-hydroxy-2-ketoglutarate(1−) | ChEBI |