EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4O6 |
| Net Charge | -2 |
| Average Mass | 160.081 |
| Monoisotopic Mass | 160.00189 |
| SMILES | O=C([O-])C(=O)CC(O)C(=O)[O-] |
| InChI | InChI=1S/C5H6O6/c6-2(4(8)9)1-3(7)5(10)11/h2,6H,1H2,(H,8,9)(H,10,11)/p-2 |
| InChIKey | WXSKVKPSMAHCSG-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2-oxoglutarate(2−) (CHEBI:17742) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 4-hydroxy-2-oxoglutarate(2−) (CHEBI:17742) has role human metabolite (CHEBI:77746) |
| 4-hydroxy-2-oxoglutarate(2−) (CHEBI:17742) is a oxo dicarboxylate (CHEBI:36147) |
| 4-hydroxy-2-oxoglutarate(2−) (CHEBI:17742) is conjugate base of 4-hydroxy-2-oxoglutarate(1−) (CHEBI:36148) |
| Incoming Relation(s) |
| D-4-hydroxy-2-oxoglutarate(2−) (CHEBI:62213) is a 4-hydroxy-2-oxoglutarate(2−) (CHEBI:17742) |
| L-4-hydroxy-2-oxoglutarate(2−) (CHEBI:71685) is a 4-hydroxy-2-oxoglutarate(2−) (CHEBI:17742) |
| 4-hydroxy-2-oxoglutarate(1−) (CHEBI:36148) is conjugate acid of 4-hydroxy-2-oxoglutarate(2−) (CHEBI:17742) |
| IUPAC Name |
|---|
| 2-hydroxy-4-oxopentanedioate |
| Synonyms | Source |
|---|---|
| 2-hydroxy-4-oxoglutarate | ChEBI |
| 2-keto-4-hydroxyglutarate | MetaCyc |
| 2-oxo-4-hydroxyglutarate | MetaCyc |
| 4-hydroxy-2-ketoglutarate | MetaCyc |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-2-oxoglutarate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4-HYDROXY-2-KETO-GLUTARATE | MetaCyc |
| C01127 | KEGG COMPOUND |