EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14ClN3O.HCl |
| Net Charge | 0 |
| Average Mass | 336.222 |
| Monoisotopic Mass | 335.05922 |
| SMILES | CNC1=Nc2ccc(Cl)cc2C(c2ccccc2)=N(=O)C1.Cl |
| InChI | InChI=1S/C16H14ClN3O.ClH/c1-18-15-10-20(21)16(11-5-3-2-4-6-11)13-9-12(17)7-8-14(13)19-15;/h2-9H,10H2,1H3,(H,18,19);1H |
| InChIKey | DMLFJMQTNDSRFU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlordiazepoxide hydrochloride (CHEBI:3612) has part chlordiazepoxide (CHEBI:3611) |
| chlordiazepoxide hydrochloride (CHEBI:3612) has role anxiolytic drug (CHEBI:35474) |
| chlordiazepoxide hydrochloride (CHEBI:3612) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 7-chloro-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-amine 4-oxide hydrochloride |
| Synonym | Source |
|---|---|
| chlordiazepoxide monohydrochloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Librium | KEGG DRUG |
| Equibral | ChemIDplus |
| A-Poxide | ChemIDplus |
| Ansiacal | ChemIDplus |
| Balance | DrugBank |
| Benzodiapin | ChemIDplus |