EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3611 - chlordiazepoxide
| Formula | C16H14ClN3O |
| Net Charge | 0 |
| Average Mass | 299.761 |
| Monoisotopic Mass | 299.08254 |
| SMILES | CNC1=Nc2ccc(Cl)cc2C(c2ccccc2)=N(=O)C1 |
| InChI | InChI=1S/C16H14ClN3O/c1-18-15-10-20(21)16(11-5-3-2-4-6-11)13-9-12(17)7-8-14(13)19-15/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | ANTSCNMPPGJYLG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. anaesthesia adjuvant Any substance that possesses little anaesthetic effect by itself, but which enhances or potentiates the anaesthetic action of other drugs when given at the same time. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlordiazepoxide (CHEBI:3611) has role anaesthesia adjuvant (CHEBI:60807) |
| chlordiazepoxide (CHEBI:3611) has role anxiolytic drug (CHEBI:35474) |
| chlordiazepoxide (CHEBI:3611) has role sedative (CHEBI:35717) |
| chlordiazepoxide (CHEBI:3611) is a N-oxide (CHEBI:35580) |
| chlordiazepoxide (CHEBI:3611) is a benzodiazepine (CHEBI:22720) |
| chlordiazepoxide (CHEBI:3611) is a organochlorine compound (CHEBI:36683) |
| chlordiazepoxide (CHEBI:3611) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| chlordiazepoxide hydrochloride (CHEBI:3612) has part chlordiazepoxide (CHEBI:3611) |
| IUPAC Name |
|---|
| 7-chloro-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-amine 4-oxide |
| INNs | Source |
|---|---|
| chlordiazepoxide | ChemIDplus |
| chlordiazepoxidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 7-chloro-2-methylamino-5-phenyl-3H-1,4-benzodiazepin-4-oxide | NIST Chemistry WebBook |
| CDP | NIST Chemistry WebBook |
| chlordiazepoxide base | DrugBank |
| clopoxide | NIST Chemistry WebBook |
| methaminodiazepoxide | ChemIDplus |
| Brand Names | Source |
|---|---|
| Helogaphen | DrugBank |
| Libritabs | ChemIDplus |
| Multum | DrugBank |
| Risolid | DrugBank |
| Silibrin | DrugBank |
| Tropium | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 594 | DrugCentral |
| Chlordiazepoxide | Wikipedia |
| D00267 | KEGG DRUG |
| DB00475 | DrugBank |
| HMDB0014618 | HMDB |
| MY6500040 | Patent |
| US2893992 | Patent |
| US3122474 | Patent |
| Citations |
|---|