EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10NO2 |
| Net Charge | -1 |
| Average Mass | 128.151 |
| Monoisotopic Mass | 128.07170 |
| SMILES | O=C([O-])C1CCCCN1 |
| InChI | InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)/p-1 |
| InChIKey | HXEACLLIILLPRG-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pipecolate (CHEBI:36110) has role human metabolite (CHEBI:77746) |
| pipecolate (CHEBI:36110) is a piperidinecarboxylate (CHEBI:36109) |
| pipecolate (CHEBI:36110) is conjugate base of pipecolic acid (CHEBI:17964) |
| Incoming Relation(s) |
| D-pipecolate (CHEBI:18703) is a pipecolate (CHEBI:36110) |
| L-pipecolate (CHEBI:30633) is a pipecolate (CHEBI:36110) |
| pipecolic acid (CHEBI:17964) is conjugate acid of pipecolate (CHEBI:36110) |
| IUPAC Name |
|---|
| piperidine-2-carboxylate |