EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10NO2 |
| Net Charge | -1 |
| Average Mass | 128.151 |
| Monoisotopic Mass | 128.07170 |
| SMILES | [H][C@]1(C(=O)[O-])CCCCN1 |
| InChI | InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)/p-1/t5-/m1/s1 |
| InChIKey | HXEACLLIILLPRG-RXMQYKEDSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (2871866) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-pipecolate (CHEBI:18703) has role human metabolite (CHEBI:77746) |
| D-pipecolate (CHEBI:18703) is a pipecolate (CHEBI:36110) |
| D-pipecolate (CHEBI:18703) is conjugate base of D-pipecolic acid (CHEBI:41582) |
| D-pipecolate (CHEBI:18703) is enantiomer of L-pipecolate (CHEBI:30633) |
| Incoming Relation(s) |
| D-pipecolic acid (CHEBI:41582) is conjugate acid of D-pipecolate (CHEBI:18703) |
| L-pipecolate (CHEBI:30633) is enantiomer of D-pipecolate (CHEBI:18703) |
| IUPAC Name |
|---|
| (2R)-piperidine-2-carboxylate |
| Synonym | Source |
|---|---|
| (R)-pipecolate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:533523 | Gmelin |