EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7AsNO3.Na |
| Net Charge | 0 |
| Average Mass | 239.038 |
| Monoisotopic Mass | 238.95396 |
| SMILES | Nc1ccc([As](=O)([O-])O)cc1.[Na+] |
| InChI | InChI=1S/C6H8AsNO3.Na/c8-6-3-1-5(2-4-6)7(9,10)11;/h1-4H,8H2,(H2,9,10,11);/q;+1/p-1 |
| InChIKey | OUFRIWNNMFWZTM-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | antisyphilitic drug A substance that is used in the treatment of syphilis. |
| Application: | antisyphilitic drug A substance that is used in the treatment of syphilis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium arsanilate (CHEBI:36049) has part arsanilate(1−) (CHEBI:36048) |
| sodium arsanilate (CHEBI:36049) has role antisyphilitic drug (CHEBI:36051) |
| sodium arsanilate (CHEBI:36049) is a organic sodium salt (CHEBI:38700) |
| sodium arsanilate (CHEBI:36049) is a organoarsonic acid salt (CHEBI:50957) |
| IUPAC Name |
|---|
| sodium hydrogen (4-aminophenyl)arsonate |
| Synonyms | Source |
|---|---|
| (4-aminophenyl)arsonic acid sodium salt | ChemIDplus |
| Atoxyl | ChemIDplus |
| monosodium (4-aminophenyl)arsonate | ChemIDplus |
| arsanilic acid sodium salt | ChemIDplus |
| sodium aminarsonate | ChemIDplus |
| sodium p-aminophenylarsonate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5789398 | Beilstein |
| CAS:127-85-5 | ChemIDplus |