EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7AsNO3 |
| Net Charge | -1 |
| Average Mass | 216.048 |
| Monoisotopic Mass | 215.96474 |
| SMILES | Nc1ccc([As](=O)([O-])O)cc1 |
| InChI | InChI=1S/C6H8AsNO3/c8-6-3-1-5(2-4-6)7(9,10)11/h1-4H,8H2,(H2,9,10,11)/p-1 |
| InChIKey | XKNKHVGWJDPIRJ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arsanilate(1−) (CHEBI:36048) is a organoarsonic acid anion (CHEBI:50956) |
| arsanilate(1−) (CHEBI:36048) is conjugate base of arsanilic acid (CHEBI:49477) |
| Incoming Relation(s) |
| sodium arsanilate (CHEBI:36049) has part arsanilate(1−) (CHEBI:36048) |
| arsanilic acid (CHEBI:49477) is conjugate acid of arsanilate(1−) (CHEBI:36048) |
| IUPAC Name |
|---|
| hydrogen (4-aminophenyl)arsonate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:327879 | Gmelin |