EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5NOS |
| Net Charge | 0 |
| Average Mass | 127.168 |
| Monoisotopic Mass | 127.00918 |
| SMILES | [H][C@@]12CC(=O)N1C=CS2 |
| InChI | InChI=1S/C5H5NOS/c7-4-3-5-6(4)1-2-8-5/h1-2,5H,3H2/t5-/m1/s1 |
| InChIKey | HHXMXAQDOUCLDN-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penem (CHEBI:35994) has functional parent penam (CHEBI:35991) |
| penem (CHEBI:35994) is a penems (CHEBI:35996) |
| IUPAC Name |
|---|
| 2,3-didehydropenam |
| Synonym | Source |
|---|---|
| (5R)-4-thia-1-azabicyclo[3.2.0]hept-2-en-7-one | IUPAC |