EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NOS |
| Net Charge | 0 |
| Average Mass | 129.184 |
| Monoisotopic Mass | 129.02483 |
| SMILES | [H][C@@]12CC(=O)N1CCS2 |
| InChI | InChI=1S/C5H7NOS/c7-4-3-5-6(4)1-2-8-5/h5H,1-3H2/t5-/m1/s1 |
| InChIKey | WSHJJCPTKWSMRR-RXMQYKEDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penam (CHEBI:35991) is a natural product fundamental parent (CHEBI:35507) |
| penam (CHEBI:35991) is a penams (CHEBI:35992) |
| Incoming Relation(s) |
| penem (CHEBI:35994) has functional parent penam (CHEBI:35991) |
| IUPAC Name |
|---|
| penam |
| Synonyms | Source |
|---|---|
| (5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one | IUPAC |
| clavams | ChEBI |
| clavam | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Clavam | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4374479 | Beilstein |