EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N3O10 |
| Net Charge | -2 |
| Average Mass | 391.333 |
| Monoisotopic Mass | 391.12379 |
| SMILES | O=C([O-])CN(CCN(CCN(CC(=O)[O-])CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H23N3O10/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27)/p-2 |
| InChIKey | QPCDCPDFJACHGM-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentetate(2−) (CHEBI:35762) is a pentacarboxylic acid anion (CHEBI:35755) |
| pentetate(2−) (CHEBI:35762) is conjugate acid of pentetate(3−) (CHEBI:35752) |
| pentetate(2−) (CHEBI:35762) is conjugate base of pentetate(1−) (CHEBI:35764) |
| Incoming Relation(s) |
| pentetate(1−) (CHEBI:35764) is conjugate acid of pentetate(2−) (CHEBI:35762) |
| pentetate(3−) (CHEBI:35752) is conjugate base of pentetate(2−) (CHEBI:35762) |
| IUPAC Name |
|---|
| 2,2'-([(carboxymethyl)imino]bis{ethane-2,1-diyl[(carboxymethyl)azanediyl]})diacetate |
| Synonyms | Source |
|---|---|
| H3dtpa | IUPAC |
| H3dtpa2− | ChEBI |
| trihydrogen diethylenetriaminepentaacetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:625544 | Gmelin |