EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N3O10 |
| Net Charge | -3 |
| Average Mass | 390.325 |
| Monoisotopic Mass | 390.11651 |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)O)CCN(CC(=O)[O-])CC(=O)O |
| InChI | InChI=1S/C14H23N3O10/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27)/p-3 |
| InChIKey | QPCDCPDFJACHGM-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentetate(3−) (CHEBI:35752) is a pentacarboxylic acid anion (CHEBI:35755) |
| pentetate(3−) (CHEBI:35752) is conjugate acid of pentetate(4−) (CHEBI:35760) |
| pentetate(3−) (CHEBI:35752) is conjugate base of pentetate(2−) (CHEBI:35762) |
| Incoming Relation(s) |
| pentetate(2−) (CHEBI:35762) is conjugate acid of pentetate(3−) (CHEBI:35752) |
| pentetate(4−) (CHEBI:35760) is conjugate base of pentetate(3−) (CHEBI:35752) |
| IUPAC Name |
|---|
| (bis{2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}amino)acetate |
| Synonyms | Source |
|---|---|
| H2dtpa3− | ChEBI |
| H2dtpa | IUPAC |
| dihydrogen diethylenetriaminepentaacetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6546711 | Beilstein |
| Gmelin:385714 | Gmelin |