EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O2 |
| Net Charge | -1 |
| Average Mass | 301.450 |
| Monoisotopic Mass | 301.21730 |
| SMILES | [H][C@@]12CC=C3C=C(C(C)C)CC[C@]3([H])[C@@]1(C)CCC[C@@]2(C)C(=O)[O-] |
| InChI | InChI=1S/C20H30O2/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22/h7,12-13,16-17H,5-6,8-11H2,1-4H3,(H,21,22)/p-1/t16-,17+,19+,20+/m0/s1 |
| InChIKey | RSWGJHLUYNHPMX-ONCXSQPRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abietate (CHEBI:35680) is a abietane diterpenoid (CHEBI:36762) |
| abietate (CHEBI:35680) is a monocarboxylic acid anion (CHEBI:35757) |
| abietate (CHEBI:35680) is conjugate base of abietic acid (CHEBI:28987) |
| Incoming Relation(s) |
| abietic acid (CHEBI:28987) is conjugate acid of abietate (CHEBI:35680) |
| IUPAC Name |
|---|
| abieta-7,13-dien-18-oate |
| UniProt Name | Source |
|---|---|
| abieta-7,13-dien-18-oate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:385720 | Gmelin |