EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CC=C3C=C(C(C)C)CC[C@]3([H])[C@@]1(C)CCC[C@@]2(C)C(=O)O |
| InChI | InChI=1S/C20H30O2/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22/h7,12-13,16-17H,5-6,8-11H2,1-4H3,(H,21,22)/t16-,17+,19+,20+/m0/s1 |
| InChIKey | RSWGJHLUYNHPMX-ONCXSQPRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abietic acid (CHEBI:28987) has role plant metabolite (CHEBI:76924) |
| abietic acid (CHEBI:28987) is a abietane diterpenoid (CHEBI:36762) |
| abietic acid (CHEBI:28987) is a monocarboxylic acid (CHEBI:25384) |
| abietic acid (CHEBI:28987) is conjugate acid of abietate (CHEBI:35680) |
| Incoming Relation(s) |
| dehydroabietic acid (CHEBI:29571) has functional parent abietic acid (CHEBI:28987) |
| abietate (CHEBI:35680) is conjugate base of abietic acid (CHEBI:28987) |
| IUPAC Name |
|---|
| abieta-7,13-dien-18-oic acid |
| Synonyms | Source |
|---|---|
| 13-isopropylpodocarpa-7,13-dien-15-oic acid | ChemIDplus |
| (1R,4aR,10aR)-1,4a-dimethyl-7-(propan-2-yl)-1,2,3,4,4a,5,6,10,10a-decahydrophenanthrene-1-carboxylic acid | ChEBI |
| 7,13-abietadien-18-oic acid | ChemIDplus |
| Abietic acid | KEGG COMPOUND |
| sylvic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Abietic_acid | Wikipedia |
| C00000871 | KNApSAcK |
| C06087 | KEGG COMPOUND |
| LMPR0104050001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Gmelin:114879 | Gmelin |
| Reaxys:2221451 | Reaxys |
| CAS:514-10-3 | KEGG COMPOUND |
| CAS:514-10-3 | ChemIDplus |
| Citations |
|---|