EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O8 |
| Net Charge | 0 |
| Average Mass | 346.336 |
| Monoisotopic Mass | 346.13762 |
| SMILES | [H][C@](/N=C1/CC(O)(CO)CC(NCC(=O)O)=C1OC)(C(=O)O)[C@H](C)O |
| InChI | InChI=1S/C14H22N2O8/c1-7(18)11(13(21)22)16-9-4-14(23,6-17)3-8(12(9)24-2)15-5-10(19)20/h7,11,15,17-18,23H,3-6H2,1-2H3,(H,19,20)(H,21,22)/b16-9-/t7-,11+,14?/m0/s1 |
| InChIKey | VIZAVBQHHMQOQF-KKUJBODISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| porphyra-334 (CHEBI:35671) is a ketimine (CHEBI:33272) |
| porphyra-334 (CHEBI:35671) is a mycosporine-like amino acid (CHEBI:35738) |
| IUPAC Name |
|---|
| (2R,3S)-2-{[(1Z)-3-[(carboxymethyl)amino]-5-hydroxy-5-(hydroxymethyl)-2-methoxycyclohex-2-en-1-ylidene]amino}-3-hydroxybutanoic acid |