EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2 |
| Net Charge | 0 |
| Average Mass | 282.431 |
| Monoisotopic Mass | 282.20960 |
| SMILES | [H][C@@]12C[C@H](CC)[C@@H](CC)CN1CCc1c2nc2ccccc12 |
| InChI | InChI=1S/C19H26N2/c1-3-13-11-18-19-16(9-10-21(18)12-14(13)4-2)15-7-5-6-8-17(15)20-19/h5-8,13-14,18,20H,3-4,9-12H2,1-2H3/t13-,14-,18-/m0/s1 |
| InChIKey | YRMJWKVAHZDIHE-DEYYWGMASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| corynan (CHEBI:35653) is a indole alkaloid (CHEBI:38958) |
| corynan (CHEBI:35653) is a indole alkaloid fundamental parent (CHEBI:38482) |
| Incoming Relation(s) |
| geissospermine (CHEBI:27776) has parent hydride corynan (CHEBI:35653) |
| IUPAC Name |
|---|
| corynan |
| Synonym | Source |
|---|---|
| (2S,3R,12bS)-2,3-diethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:89894 | Beilstein |