EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H48N4O3 |
| Net Charge | 0 |
| Average Mass | 632.849 |
| Monoisotopic Mass | 632.37264 |
| SMILES | [H][C@@]1(CC)CN2CC[C@]34c5ccccc5N5[C@@]3([H])[C@@]([H])(CO[C@@]5([H])[C@]([H])(C(=O)OC)[C@@]3([H])C[C@@]5([H])c6nc7ccccc7c6CCN5C/C3=C/C)[C@@]1([H])C[C@]24[H] |
| InChI | InChI=1S/C40H48N4O3/c1-4-23-21-43-17-15-40-30-11-7-9-13-32(30)44-37(40)29(27(23)19-34(40)43)22-47-38(44)35(39(45)46-3)28-18-33-36-26(14-16-42(33)20-24(28)5-2)25-10-6-8-12-31(25)41-36/h5-13,23,27-29,33-35,37-38,41H,4,14-22H2,1-3H3/b24-5-/t23-,27+,28+,29+,33+,34+,35-,37+,38+,40-/m1/s1 |
| InChIKey | ISDWYSGTYITCHG-OCNKQYNFSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geissospermine (CHEBI:27776) has parent hydride corynan (CHEBI:35653) |
| geissospermine (CHEBI:27776) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| geissospermine (CHEBI:27776) is a indole alkaloid (CHEBI:38958) |
| geissospermine (CHEBI:27776) is a methyl ester (CHEBI:25248) |
| geissospermine (CHEBI:27776) is a organic heteropentacyclic compound (CHEBI:38164) |
| geissospermine (CHEBI:27776) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| methyl (2R)-[(3aR,9S,11aS,11bS,12S,13aS,14S)-14-ethyl-2,3,11a,12,13,13a-hexahydro-11H,11bH-1,12-ethano[1,3]oxazino[3,4,5-lm]pyrrolo[2,3-d]carbazol-9-yl][(2R,3E,12bS)-3-ethylidene-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]acetate |
| Synonym | Source |
|---|---|
| Geissospermine | KEGG COMPOUND |
| Citations |
|---|