EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O |
| Net Charge | 0 |
| Average Mass | 296.414 |
| Monoisotopic Mass | 296.18886 |
| SMILES | [H][C@@]12CC[C@H](O)C[C@@]1([H])C[C@@]1([H])c3nc4ccccc4c3CCN1C2 |
| InChI | InChI=1S/C19H24N2O/c22-14-6-5-12-11-21-8-7-16-15-3-1-2-4-17(15)20-19(16)18(21)10-13(12)9-14/h1-4,12-14,18,20,22H,5-11H2/t12-,13-,14-,18-/m0/s1 |
| InChIKey | YZHQOLWNBFSHQZ-NUXNZHGMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17α-yohimbol (CHEBI:35636) is a 17-yohimbol (CHEBI:35637) |
| Incoming Relation(s) |
| yohimbic acid (CHEBI:35633) has functional parent 17α-yohimbol (CHEBI:35636) |
| IUPAC Name |
|---|
| yohimban-17α-ol |
| Registry Numbers | Sources |
|---|---|
| Beilstein:92823 | Beilstein |