EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O3 |
| Net Charge | 0 |
| Average Mass | 340.423 |
| Monoisotopic Mass | 340.17869 |
| SMILES | [H][C@@]12CC[C@H](O)[C@]([H])(C(=O)O)[C@@]1([H])C[C@@]1([H])c3nc4ccccc4c3CCN1C2 |
| InChI | InChI=1S/C20H24N2O3/c23-17-6-5-11-10-22-8-7-13-12-3-1-2-4-15(12)21-19(13)16(22)9-14(11)18(17)20(24)25/h1-4,11,14,16-18,21,23H,5-10H2,(H,24,25)/t11-,14-,16-,17-,18+/m0/s1 |
| InChIKey | AADVZSXPNRLYLV-GKMXPDSGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yohimbic acid (CHEBI:35633) has functional parent 17α-yohimbol (CHEBI:35636) |
| yohimbic acid (CHEBI:35633) is a yohimban alkaloid (CHEBI:27358) |
| Incoming Relation(s) |
| yohimbine (CHEBI:10093) has functional parent yohimbic acid (CHEBI:35633) |
| IUPAC Name |
|---|
| 17α-hydroxyyohimban-16α-carboxylic acid |
| Synonyms | Source |
|---|---|
| yohimbic acid | ChemIDplus |
| yohimbinic acid | ChemIDplus |
| Yohimbinsäure | ChEBI |