EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2 |
| Net Charge | 0 |
| Average Mass | 280.415 |
| Monoisotopic Mass | 280.19395 |
| SMILES | [H][C@@]12CCCC[C@@]1([H])C[C@@]1([H])c3nc4ccccc4c3CCN1C2 |
| InChI | InChI=1S/C19H24N2/c1-2-6-14-12-21-10-9-16-15-7-3-4-8-17(15)20-19(16)18(21)11-13(14)5-1/h3-4,7-8,13-14,18,20H,1-2,5-6,9-12H2/t13-,14-,18-/m0/s1 |
| InChIKey | JUPDIHMJFPDGMY-DEYYWGMASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yohimban (CHEBI:35631) is a indole alkaloid (CHEBI:38958) |
| yohimban (CHEBI:35631) is a indole alkaloid fundamental parent (CHEBI:38482) |
| yohimban (CHEBI:35631) is a yohimban alkaloid (CHEBI:27358) |
| Incoming Relation(s) |
| 17-yohimbol (CHEBI:35637) has parent hydride yohimban (CHEBI:35631) |
| deserpidine (CHEBI:27478) has parent hydride yohimban (CHEBI:35631) |
| rescinnamine (CHEBI:28572) has parent hydride yohimban (CHEBI:35631) |
| IUPAC Name |
|---|
| yohimban |
| Synonym | Source |
|---|---|
| deoxyohimbol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:90731 | Beilstein |
| Beilstein:4909341 | Beilstein |
| CAS:523-06-8 | ChemIDplus |