EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38N2O8 |
| Net Charge | 0 |
| Average Mass | 578.662 |
| Monoisotopic Mass | 578.26282 |
| SMILES | [H][C@]12C[C@@H](OC(=O)c3cc(OC)c(OC)c(OC)c3)[C@H](OC)[C@@H](C(=O)OC)[C@@]1([H])C[C@]1([H])c3nc4ccccc4c3CCN1C2 |
| InChI | InChI=1S/C32H38N2O8/c1-37-24-12-17(13-25(38-2)29(24)39-3)31(35)42-26-14-18-16-34-11-10-20-19-8-6-7-9-22(19)33-28(20)23(34)15-21(18)27(30(26)40-4)32(36)41-5/h6-9,12-13,18,21,23,26-27,30,33H,10-11,14-16H2,1-5H3/t18-,21+,23-,26-,27+,30+/m1/s1 |
| InChIKey | CVBMAZKKCSYWQR-WCGOZPBSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deserpidine (CHEBI:27478) has parent hydride yohimban (CHEBI:35631) |
| deserpidine (CHEBI:27478) is a alkaloid ester (CHEBI:38481) |
| deserpidine (CHEBI:27478) is a benzoate ester (CHEBI:36054) |
| deserpidine (CHEBI:27478) is a methyl ester (CHEBI:25248) |
| deserpidine (CHEBI:27478) is a organic heteropentacyclic compound (CHEBI:38164) |
| deserpidine (CHEBI:27478) is a yohimban alkaloid (CHEBI:27358) |
| IUPAC Name |
|---|
| methyl (3β,16β,17α,18β,20α)-17-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]yohimban-16-carboxylate |
| Synonyms | Source |
|---|---|
| Deserpidine | KEGG COMPOUND |
| (3β,16β,17α,18β,20α)-17-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]yohimban-16-carboxylic acid methyl ester | NIST Chemistry WebBook |
| 11-demethoxyreserpine | ChemIDplus |
| 11-desmethoxyreserpine | ChemIDplus |
| canescine | ChemIDplus |
| recanescine | ChemIDplus |