EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O |
| Net Charge | 0 |
| Average Mass | 132.162 |
| Monoisotopic Mass | 132.05751 |
| SMILES | C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C9H8O/c1-2-6-9-8(4-1)5-3-7-10-9/h1-6H,7H2 |
| InChIKey | KYNSBQPICQTCGU-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2H-chromene (CHEBI:35601) is a chromene (CHEBI:35602) |
| 2H-chromene (CHEBI:35601) is a organic heterobicyclic compound (CHEBI:27171) |
| 2H-chromene (CHEBI:35601) is tautomer of 4H-chromene (CHEBI:35603) |
| Incoming Relation(s) |
| abyssinone I (CHEBI:2367) has parent hydride 2H-chromene (CHEBI:35601) |
| chromenyliums (CHEBI:72704) has parent hydride 2H-chromene (CHEBI:35601) |
| 4H-chromene (CHEBI:35603) is tautomer of 2H-chromene (CHEBI:35601) |
| IUPAC Name |
|---|
| 2H-chromene |
| Synonyms | Source |
|---|---|
| 1,2-benzopyran | ChemIDplus |
| 2H-1-benzopyran | ChemIDplus |
| 3-chromene | NIST Chemistry WebBook |
| Δ-3-chromene | NIST Chemistry WebBook |