EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O4 |
| Net Charge | 0 |
| Average Mass | 322.360 |
| Monoisotopic Mass | 322.12051 |
| SMILES | CC1(C)C=Cc2cc([C@@H]3CC(=O)c4ccc(O)cc4O3)ccc2O1 |
| InChI | InChI=1S/C20H18O4/c1-20(2)8-7-13-9-12(3-6-17(13)24-20)18-11-16(22)15-5-4-14(21)10-19(15)23-18/h3-10,18,21H,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | MITHUEHYZARDCT-SFHVURJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina abyssinica (ncbitaxon:1237573) | - | PubMed (21116437) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abyssinone I (CHEBI:2367) has parent hydride 2H-chromene (CHEBI:35601) |
| abyssinone I (CHEBI:2367) has role apoptosis inhibitor (CHEBI:68494) |
| abyssinone I (CHEBI:2367) has role plant metabolite (CHEBI:76924) |
| abyssinone I (CHEBI:2367) is a monohydroxyflavanone (CHEBI:38748) |
| abyssinone I (CHEBI:2367) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2S)-7-hydroxy-2',2'-dimethyl-2,3-dihydro-2'H,4H-2,6'-bichromen-4-one |
| Synonym | Source |
|---|---|
| Abyssinone I | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000935 | KNApSAcK |
| C09318 | KEGG COMPOUND |
| LMPK12140050 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7263568 | Reaxys |
| CAS:77263-07-1 | KEGG COMPOUND |
| Citations |
|---|