EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC(C)=C1CC[C@@H](C)CC1=O |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3/t8-/m1/s1 |
| InChIKey | NZGWDASTMWDZIW-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-pulegone (CHEBI:35596) is a p-menth-4(8)-en-3-one (CHEBI:26381) |
| IUPAC Names |
|---|
| 1β-p-menth-4(8)-en-3-one |
| (5R)-5-methyl-2-(propan-2-ylidene)cyclohexan-1-one |
| Synonyms | Source |
|---|---|
| (1R)-(+)-p-Menth-4(8)-en-3-one | ChemIDplus |
| (5R)-2-isopropylidene-5-methylcyclohexanone | ChEBI |
| d-Pulegone | ChemIDplus |
| (+)-Pulegone | KEGG COMPOUND |
| Pulegone | KEGG COMPOUND |
| (+)-(R)-Pulegone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (R)-pulegone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000827 | KNApSAcK |
| C09893 | KEGG COMPOUND |
| LMPR0102090025 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3588094 | Reaxys |
| CAS:89-82-7 | KEGG COMPOUND |
| CAS:89-82-7 | ChemIDplus |