EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | CC(C)=C1CCC(C)CC1=O |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3 |
| InChIKey | NZGWDASTMWDZIW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-menth-4(8)-en-3-one (CHEBI:26381) has role plant metabolite (CHEBI:76924) |
| p-menth-4(8)-en-3-one (CHEBI:26381) has role volatile oil component (CHEBI:27311) |
| p-menth-4(8)-en-3-one (CHEBI:26381) is a p-menthane monoterpenoid (CHEBI:25186) |
| p-menth-4(8)-en-3-one (CHEBI:26381) is a enone (CHEBI:51689) |
| Incoming Relation(s) |
| (+)-pulegone (CHEBI:35596) is a p-menth-4(8)-en-3-one (CHEBI:26381) |
| IUPAC Names |
|---|
| 5-methyl-2-(propan-2-ylidene)cyclohexan-1-one |
| p-menth-4(8)-en-3-one |
| Synonyms | Source |
|---|---|
| 1-Isopropylidene-4-methyl-2-cyclohexanone | ChemIDplus |
| 1-Methyl-4-isopropylidene-3-cyclohexanone | ChemIDplus |
| 4(8)-p-Menthen-3-one | ChemIDplus |
| 5-Methyl-2-(1-methylethylidene)cyclohexanone | ChemIDplus |
| 5-Methyl-2-isopropylidenecyclohexanone | ChemIDplus |
| (+-)-Pulegone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:15932-80-6 | ChemIDplus |
| Citations |
|---|