EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O2 |
| Net Charge | 0 |
| Average Mass | 254.414 |
| Monoisotopic Mass | 254.22458 |
| SMILES | CCCCCCCC/C=C\CCCCCC(=O)O |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h9-10H,2-8,11-15H2,1H3,(H,17,18)/b10-9- |
| InChIKey | PJHOFUXBXJNUAC-KTKRTIGZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-hexadec-7-enoic acid (CHEBI:35465) is a hexadecenoic acid (CHEBI:24548) |
| (Z)-hexadec-7-enoic acid (CHEBI:35465) is conjugate acid of (7Z)-hexadecenoate (CHEBI:82730) |
| Incoming Relation(s) |
| (7Z)-hexadecenoyl-CoA (CHEBI:88008) has functional parent (Z)-hexadec-7-enoic acid (CHEBI:35465) |
| 1-[(7Z)-hexadecenoyl]-2-[(5Z,8Z,11Z,14Z)-eicosatetraenoyl]-sn-glycero-3-phosphocholine (CHEBI:64505) has functional parent (Z)-hexadec-7-enoic acid (CHEBI:35465) |
| methyl (Z)-7-hexadecenoate (CHEBI:176577) has functional parent (Z)-hexadec-7-enoic acid (CHEBI:35465) |
| (7Z)-hexadecenoate (CHEBI:82730) is conjugate base of (Z)-hexadec-7-enoic acid (CHEBI:35465) |
| IUPAC Name |
|---|
| (7Z)-hexadec-7-enoic acid |
| Synonyms | Source |
|---|---|
| 16:1 cis7 | ChEBI |
| 7-hexadecenoic acid | ChEBI |
| (7Z)-hexadecenoic acid | ChEBI |
| 7Z-hexadecenoic acid | ChEBI |
| C16:1(n=9) | ChEBI |
| FA 16:1(7Z) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1909930 | Beilstein |
| CAS:2416-19-5 | ChemIDplus |
| Citations |
|---|