EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H32O2 |
| Net Charge | 0 |
| Average Mass | 268.441 |
| Monoisotopic Mass | 268.24023 |
| SMILES | CCCCCCCC/C=C\CCCCCC(=O)OC |
| InChI | InChI=1S/C17H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h10-11H,3-9,12-16H2,1-2H3/b11-10- |
| InChIKey | FXCDESKKWMGGON-KHPPLWFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlorella sorokiniana (ncbitaxon:3076) | - | PubMed (27689989) | |
| Lemna minor (ncbitaxon:4472) | - | PubMed (24271005) | Strain: WX3 |
| Lonicera japonica (ncbitaxon:105884) | - | PubMed (23348991) | |
| Mikania glomerata (ncbitaxon:1073848) | leaf (BTO:0000713) | PubMed (25202336) | |
| Morchella importuna (ncbitaxon:1174673) | - | PubMed (33536815) | |
| Spirodela polyrhiza (ncbitaxon:29656) | - | PubMed (24271005) | Strain: HZ1 |
| Roles Classification |
|---|
| Biological Roles: | nitrification inhibitor Any inhibitor added to nitrogen fertilizers which can reduce the rate at which ammonium is converted to nitrate. Under appropriate conditions, this can help reduce nitrogen losses through denitrification and leaching. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl (Z)-7-hexadecenoate (CHEBI:176577) has functional parent (Z)-hexadec-7-enoic acid (CHEBI:35465) |
| methyl (Z)-7-hexadecenoate (CHEBI:176577) has role algal metabolite (CHEBI:84735) |
| methyl (Z)-7-hexadecenoate (CHEBI:176577) has role fungal metabolite (CHEBI:76946) |
| methyl (Z)-7-hexadecenoate (CHEBI:176577) has role nitrification inhibitor (CHEBI:148436) |
| methyl (Z)-7-hexadecenoate (CHEBI:176577) has role plant metabolite (CHEBI:76924) |
| methyl (Z)-7-hexadecenoate (CHEBI:176577) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl (7Z)-hexadec-7-enoate |
| Synonyms | Source |
|---|---|
| (7Z)-hexadecenoic acid methyl ester | ChEBI |
| cis-7-hexadecenoate methyl ester | ChEBI |
| (Z)-7-hexadecenoic acid methyl ester | ChEBI |
| (Z)-methyl hexadec-7-enoate | NIST Chemistry WebBook |
| (Z)-methyl-hexadec-7-enoate | ChEBI |
| methyl 7Z-hexadecenoate | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061858 | HMDB |
| LMFA07010496 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:56875-67-3 | NIST Chemistry WebBook |
| Citations |
|---|