EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO6S |
| Net Charge | 0 |
| Average Mass | 219.174 |
| Monoisotopic Mass | 218.98376 |
| SMILES | O=[N+]([O-])c1ccc(OS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C6H5NO6S/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12/h1-4H,(H,10,11,12) |
| InChIKey | JBGHTSSFSSUKLR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitrophenyl hydrogen sulfate (CHEBI:35422) has functional parent 4-nitrophenol (CHEBI:16836) |
| 4-nitrophenyl hydrogen sulfate (CHEBI:35422) has role human metabolite (CHEBI:77746) |
| 4-nitrophenyl hydrogen sulfate (CHEBI:35422) is a C-nitro compound (CHEBI:35716) |
| 4-nitrophenyl hydrogen sulfate (CHEBI:35422) is a aryl sulfate (CHEBI:37919) |
| 4-nitrophenyl hydrogen sulfate (CHEBI:35422) is conjugate acid of 4-nitrophenyl sulfate (CHEBI:140994) |
| Incoming Relation(s) |
| 4-nitrophenyl sulfate (CHEBI:140994) is conjugate base of 4-nitrophenyl hydrogen sulfate (CHEBI:35422) |
| IUPAC Name |
|---|
| 4-nitrophenyl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| 4-nitrophenyl sulfate | ChemIDplus |
| para-nitrophenyl sulfate | ChemIDplus |
| p-nitrophenol sulfate | ChemIDplus |
| p-nitrophenyl sulfate | ChemIDplus |
| sulfuric acid mono(4-nitrophenyl) ester | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1080-04-2 | ChemIDplus |