EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4NO6S |
| Net Charge | -1 |
| Average Mass | 218.166 |
| Monoisotopic Mass | 217.97648 |
| SMILES | O=[N+]([O-])c1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C6H5NO6S/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12/h1-4H,(H,10,11,12)/p-1 |
| InChIKey | JBGHTSSFSSUKLR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitrophenyl sulfate (CHEBI:140994) has functional parent 4-nitrophenol (CHEBI:16836) |
| 4-nitrophenyl sulfate (CHEBI:140994) is a aryl sulfate oxoanion (CHEBI:139371) |
| 4-nitrophenyl sulfate (CHEBI:140994) is conjugate base of 4-nitrophenyl hydrogen sulfate (CHEBI:35422) |
| Incoming Relation(s) |
| 4-nitrophenyl hydrogen sulfate (CHEBI:35422) is conjugate acid of 4-nitrophenyl sulfate (CHEBI:140994) |
| IUPAC Names |
|---|
| 4-nitrophenyl sulfate |
| p-nitrophenyl sulfate |
| UniProt Name | Source |
|---|---|
| 4-nitrophenyl sulfate | UniProt |
| Citations |
|---|