EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N |
| Net Charge | 0 |
| Average Mass | 121.183 |
| Monoisotopic Mass | 121.08915 |
| SMILES | C[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C8H11N/c1-7(9)8-5-3-2-4-6-8/h2-7H,9H2,1H3/t7-/m0/s1 |
| InChIKey | RQEUFEKYXDPUSK-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-1-phenylethanamine (CHEBI:35321) is a 1-phenylethylamine (CHEBI:670) |
| (1S)-1-phenylethanamine (CHEBI:35321) is conjugate base of (1S)-1-phenylethanaminium (CHEBI:141108) |
| (1S)-1-phenylethanamine (CHEBI:35321) is enantiomer of (1R)-1-phenylethanamine (CHEBI:35322) |
| Incoming Relation(s) |
| (S)-N-acetyl-1-phenylethylamine (CHEBI:141109) has functional parent (1S)-1-phenylethanamine (CHEBI:35321) |
| (1S)-1-phenylethanaminium (CHEBI:141108) is conjugate acid of (1S)-1-phenylethanamine (CHEBI:35321) |
| (1R)-1-phenylethanamine (CHEBI:35322) is enantiomer of (1S)-1-phenylethanamine (CHEBI:35321) |
| IUPAC Name |
|---|
| (1S)-1-phenylethanamine |
| Synonyms | Source |
|---|---|
| (S)-α-methylbenzenemethanamine | ChemIDplus |
| (S)-(−)-α-methylbenzylamine | NIST Chemistry WebBook |
| L-(−)-1-phenylethylamine | NIST Chemistry WebBook |
| L(−)-α-methylbenzylamine | NIST Chemistry WebBook |
| L-α-methylbenzylamine | ChemIDplus |
| L-(−)-α-phenylethylamine | NIST Chemistry WebBook |