EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO |
| Net Charge | 0 |
| Average Mass | 163.220 |
| Monoisotopic Mass | 163.09971 |
| SMILES | CC(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C10H13NO/c1-8(11-9(2)12)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | PAVMRYVMZLANOQ-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-N-acetyl-1-phenylethylamine (CHEBI:141109) has functional parent (1S)-1-phenylethanamine (CHEBI:35321) |
| (S)-N-acetyl-1-phenylethylamine (CHEBI:141109) is a N-(1-phenylethyl)acetamide (CHEBI:141185) |
| (S)-N-acetyl-1-phenylethylamine (CHEBI:141109) is enantiomer of (R)-N-acetyl-1-phenylethylamine (CHEBI:141111) |
| Incoming Relation(s) |
| (R)-N-acetyl-1-phenylethylamine (CHEBI:141111) is enantiomer of (S)-N-acetyl-1-phenylethylamine (CHEBI:141109) |
| IUPAC Name |
|---|
| N-[(1S)-1-phenylethyl]acetamide |
| Synonyms | Source |
|---|---|
| (S)-N-(1-phenylethyl)acetamide | ChEBI |
| (S)-(−)-N-acetyl-1-methylbenzylamine | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-N-acetyl-1-phenylethylamine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3196865 | Reaxys |