EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O3 |
| Net Charge | -1 |
| Average Mass | 129.135 |
| Monoisotopic Mass | 129.05572 |
| SMILES | CCCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O3/c1-2-3-4-5(7)6(8)9/h2-4H2,1H3,(H,8,9)/p-1 |
| InChIKey | XNIHZNNZJHYHLC-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxohexanoate (CHEBI:35177) has functional parent hexanoate (CHEBI:17120) |
| 2-oxohexanoate (CHEBI:35177) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| 2-oxohexanoate (CHEBI:35177) is a oxo fatty acid anion (CHEBI:59836) |
| 2-oxohexanoate (CHEBI:35177) is conjugate base of 2-oxohexanoic acid (CHEBI:17308) |
| Incoming Relation(s) |
| 2-oxohexanoic acid (CHEBI:17308) is conjugate acid of 2-oxohexanoate (CHEBI:35177) |
| IUPAC Name |
|---|
| 2-oxohexanoate |
| Synonyms | Source |
|---|---|
| 2-ketocaproate | ChEBI |
| 2-ketohexanoate | ChEBI |
| 2-oxocaproate | ChEBI |
| 2-Oxohexanoate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 2-oxohexanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00902 | KEGG COMPOUND |
| Citations |
|---|