EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | CCCCC(=O)C(=O)O |
| InChI | InChI=1S/C6H10O3/c1-2-3-4-5(7)6(8)9/h2-4H2,1H3,(H,8,9) |
| InChIKey | XNIHZNNZJHYHLC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxohexanoic acid (CHEBI:17308) has functional parent hexanoic acid (CHEBI:30776) |
| 2-oxohexanoic acid (CHEBI:17308) has role human blood serum metabolite (CHEBI:85234) |
| 2-oxohexanoic acid (CHEBI:17308) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxohexanoic acid (CHEBI:17308) is a medium-chain fatty acid (CHEBI:59554) |
| 2-oxohexanoic acid (CHEBI:17308) is a oxo fatty acid (CHEBI:59644) |
| 2-oxohexanoic acid (CHEBI:17308) is a straight-chain fatty acid (CHEBI:59202) |
| 2-oxohexanoic acid (CHEBI:17308) is conjugate acid of 2-oxohexanoate (CHEBI:35177) |
| Incoming Relation(s) |
| 2-oxohexanoate (CHEBI:35177) is conjugate base of 2-oxohexanoic acid (CHEBI:17308) |
| IUPAC Name |
|---|
| 2-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| 2-Oxohexanoic acid | KEGG COMPOUND |
| 2-keto-n-caproic acid | LIPID MAPS |
| α-ketohexanoic acid | ChEBI |
| α-ketocaproic acid | ChemIDplus |
| 2-ketohexanoic acid | ChEBI |
| 2-oxo C6:0 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00902 | KEGG COMPOUND |
| LMFA01060007 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1749831 | Reaxys |
| CAS:2492-75-3 | ChemIDplus |
| CAS:2492-75-3 | KEGG COMPOUND |
| Citations |
|---|