EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N4O6S2 |
| Net Charge | 0 |
| Average Mass | 410.433 |
| Monoisotopic Mass | 410.03548 |
| SMILES | [H][C@]12SCC=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=C\CC(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C15H14N4O6S2/c16-15-17-7(5-27-15)6(1-2-9(20)21)11(22)18-10-12(23)19-8(14(24)25)3-4-26-13(10)19/h1,3,5,10,13H,2,4H2,(H2,16,17)(H,18,22)(H,20,21)(H,24,25)/b6-1-/t10-,13-/m1/s1 |
| InChIKey | UNJFKXSSGBWRBZ-BJCIPQKHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftibuten (CHEBI:3510) has role antibacterial drug (CHEBI:36047) |
| ceftibuten (CHEBI:3510) is a cephalosporin (CHEBI:23066) |
| ceftibuten (CHEBI:3510) is a dicarboxylic acid (CHEBI:35692) |
| Incoming Relation(s) |
| ceftibuten dihydrate (CHEBI:34618) has part ceftibuten (CHEBI:3510) |
| IUPAC Name |
|---|
| 7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-4-carboxybut-2-enoyl]amino}-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| ceftibuten | ChemIDplus |
| ceftibutene | ChemIDplus |
| ceftibutenum | ChemIDplus |
| ceftibuteno | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-4-carboxybut-2-enoyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| cis-ceftibuten | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08117 | KEGG COMPOUND |
| DB01415 | DrugBank |
| D00922 | KEGG DRUG |
| EP136721 | Patent |
| US4634697 | Patent |
| Ceftibuten | Wikipedia |
| 562 | DrugCentral |
| CN106397455 | Patent |
| CN105153198 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5892046 | Beilstein |
| CAS:97519-39-6 | KEGG COMPOUND |
| CAS:97519-39-6 | ChemIDplus |
| Citations |
|---|