EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N4O6S2.2H2O |
| Net Charge | 0 |
| Average Mass | 446.463 |
| Monoisotopic Mass | 446.05661 |
| SMILES | O.O.[H][C@]12SCC=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=C\CC(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C15H14N4O6S2.2H2O/c16-15-17-7(5-27-15)6(1-2-9(20)21)11(22)18-10-12(23)19-8(14(24)25)3-4-26-13(10)19;;/h1,3,5,10,13H,2,4H2,(H2,16,17)(H,18,22)(H,20,21)(H,24,25);2*1H2/b6-1-;;/t10-,13-;;/m1../s1 |
| InChIKey | SSWTVBYDDFPFAF-DKOGRLLHSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftibuten dihydrate (CHEBI:34618) has part ceftibuten (CHEBI:3510) |
| ceftibuten dihydrate (CHEBI:34618) has role antibacterial drug (CHEBI:36047) |
| ceftibuten dihydrate (CHEBI:34618) is a hydrate (CHEBI:35505) |
| IUPAC Names |
|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-4-carboxybut-2-enoyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid—water (1/2) |
| 7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-4-carboxybut-2-enoyl]amino}-3,4-didehydrocepham-4-carboxylic acid—water(1/2) |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-[[(Z)-2-(2-amino-1,3-thiazol-4-yl)-5-hydroxy-5-oxopent-2-enoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid dihydrate | DrugBank |
| ceftibuten | KEGG DRUG |
| ceftibuten·2H2O | ChEBI |
| ceftibuten dihydrate | KEGG DRUG |