EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N2O |
| Net Charge | +1 |
| Average Mass | 177.227 |
| Monoisotopic Mass | 177.10224 |
| SMILES | [NH3+]CCc1cnc2ccc(O)cc12 |
| InChI | InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2/p+1 |
| InChIKey | QZAYGJVTTNCVMB-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| serotonin(1+) (CHEBI:350546) has role human metabolite (CHEBI:77746) |
| serotonin(1+) (CHEBI:350546) is a ammonium ion derivative (CHEBI:35274) |
| serotonin(1+) (CHEBI:350546) is conjugate acid of serotonin (CHEBI:28790) |
| Incoming Relation(s) |
| serotonin (CHEBI:28790) is conjugate base of serotonin(1+) (CHEBI:350546) |
| IUPAC Name |
|---|
| 2-(5-hydroxy-1H-indol-3-yl)ethanaminium |
| Synonym | Source |
|---|---|
| serotonin cation | ChEBI |
| UniProt Name | Source |
|---|---|
| serotonin | UniProt |