EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3Cl3N2O2 |
| Net Charge | 0 |
| Average Mass | 241.461 |
| Monoisotopic Mass | 239.92601 |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C6H3Cl3N2O2/c7-1-3(10)2(8)5(9)11-4(1)6(12)13/h(H2,10,11)(H,12,13) |
| InChIKey | NQQVFXUMIDALNH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | herbicide A substance used to destroy plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| picloram (CHEBI:34922) has functional parent picolinic acid (CHEBI:28747) |
| picloram (CHEBI:34922) has role herbicide (CHEBI:24527) |
| picloram (CHEBI:34922) has role synthetic auxin (CHEBI:26841) |
| picloram (CHEBI:34922) is a aminopyridine (CHEBI:38207) |
| picloram (CHEBI:34922) is a chloropyridine (CHEBI:39173) |
| picloram (CHEBI:34922) is a organochlorine pesticide (CHEBI:38656) |
| picloram (CHEBI:34922) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Incoming Relation(s) |
| picloram-methyl (CHEBI:145557) has functional parent picloram (CHEBI:34922) |
| IUPAC Name |
|---|
| 4-amino-3,5,6-trichloropyridine-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 3,5,6-trichloro-4-amino-2-pyridinecarboxylic acid | ChEBI |
| 3,5,6-trichloro-4-aminopicolinic acid | ChemIDplus |
| 4-amino-3,5,6-trichloro-2-picolinic acid | ChemIDplus |
| 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid | Alan Wood's Pesticides |
| 4-amino-3,5,6-trichloropicolinic acid | Alan Wood's Pesticides |
| picloram acid | PPDB |
| Brand Names | Source |
|---|---|
| Access | ChEBI |
| Amdon | ChemIDplus |
| Borolin | ChemIDplus |
| Grazon | ChEBI |
| K-Pin | ChemIDplus |
| Pathway | ChEBI |
| Citations |
|---|