EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5Cl3N2O2 |
| Net Charge | 0 |
| Average Mass | 255.488 |
| Monoisotopic Mass | 253.94166 |
| SMILES | COC(=O)c1nc(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C7H5Cl3N2O2/c1-14-7(13)5-2(8)4(11)3(9)6(10)12-5/h1H3,(H2,11,12) |
| InChIKey | RJQUHEYNLDNJLN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| picloram-methyl (CHEBI:145557) has functional parent picloram (CHEBI:34922) |
| picloram-methyl (CHEBI:145557) has role herbicide (CHEBI:24527) |
| picloram-methyl (CHEBI:145557) is a aminopyridine (CHEBI:38207) |
| picloram-methyl (CHEBI:145557) is a chloropyridine (CHEBI:39173) |
| picloram-methyl (CHEBI:145557) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| Synonyms | Source |
|---|---|
| 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid methyl ester | ChEBI |
| 4-amino-3,5,6-trichloropicolinic acid methyl ester | ChEBI |
| methyl 4-amino-3,5,6-trichloro-2-pyridinecarboxylate | ChEBI |
| methyl 4-amino-3,5,6-trichloropicolinate | Alan Wood's Pesticides |
| picloram methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| /derivatives/picloram-methyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:14143-55-6 | ChemIDplus |
| CAS:14143-55-6 | NIST Chemistry WebBook |