EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20Cl2O3 |
| Net Charge | 0 |
| Average Mass | 391.294 |
| Monoisotopic Mass | 390.07895 |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C21H20Cl2O3/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3 |
| InChIKey | RLLPVAHGXHCWKJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | scabicide An acaricide that kills mites of the genus Sarcoptes. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| permethrin (CHEBI:34911) has functional parent 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid (CHEBI:39308) |
| permethrin (CHEBI:34911) has role agrochemical (CHEBI:33286) |
| permethrin (CHEBI:34911) has role ectoparasiticide (CHEBI:38956) |
| permethrin (CHEBI:34911) has role pyrethroid ester acaricide (CHEBI:39259) |
| permethrin (CHEBI:34911) has role pyrethroid ester insecticide (CHEBI:39116) |
| permethrin (CHEBI:34911) has role scabicide (CHEBI:73333) |
| permethrin (CHEBI:34911) is a cyclopropanecarboxylate ester (CHEBI:50351) |
| permethrin (CHEBI:34911) is a cyclopropanes (CHEBI:51454) |
| Incoming Relation(s) |
| trans-permethrin (CHEBI:62521) is a permethrin (CHEBI:34911) |
| IUPAC Name |
|---|
| 3-phenoxybenzyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| INN | Source |
|---|---|
| permethrin | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropane carboxylic acid, (3-phenoxyphenyl) methyl ester | ChemIDplus |
| (3-Phenoxyphenyl)methyl (±)-cis,trans-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate | ChemIDplus |
| Permethrin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5765325 | Reaxys |
| CAS:52645-53-1 | KEGG COMPOUND |
| CAS:52645-53-1 | ChemIDplus |
| Citations |
|---|