EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10N2O |
| Net Charge | 0 |
| Average Mass | 102.137 |
| Monoisotopic Mass | 102.07931 |
| SMILES | CCN(CC)N=O |
| InChI | InChI=1S/C4H10N2O/c1-3-6(4-2)5-7/h3-4H2,1-2H3 |
| InChIKey | WBNQDOYYEUMPFS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-nitrosodiethylamine (CHEBI:34873) has role carcinogenic agent (CHEBI:50903) |
| N-nitrosodiethylamine (CHEBI:34873) has role hepatotoxic agent (CHEBI:50908) |
| N-nitrosodiethylamine (CHEBI:34873) has role mutagen (CHEBI:25435) |
| N-nitrosodiethylamine (CHEBI:34873) is a nitrosamine (CHEBI:35803) |
| Incoming Relation(s) |
| N-ethyl-N-(2-hydroxyethyl)nitrosamine (CHEBI:141568) has functional parent N-nitrosodiethylamine (CHEBI:34873) |
| IUPAC Name |
|---|
| N-ethyl-N-nitrosoethanamine |
| Synonyms | Source |
|---|---|
| 1,1-diethyl-2-oxohydrazine | NIST Chemistry WebBook |
| DANA | NIST Chemistry WebBook |
| DEN | NIST Chemistry WebBook |
| Diethylnitrosamine | KEGG COMPOUND |
| diethylnitrosoamine | ChemIDplus |
| N,N-diethylnitrosamine | ChemIDplus |
| Citations |
|---|