EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10N2O |
| Net Charge | 0 |
| Average Mass | 102.137 |
| Monoisotopic Mass | 102.07931 |
| SMILES | CCN(CC)N=O |
| InChI | InChI=1S/C4H10N2O/c1-3-6(4-2)5-7/h3-4H2,1-2H3 |
| InChIKey | WBNQDOYYEUMPFS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-nitrosodiethylamine (CHEBI:34873) has role carcinogenic agent (CHEBI:50903) |
| N-nitrosodiethylamine (CHEBI:34873) has role hepatotoxic agent (CHEBI:50908) |
| N-nitrosodiethylamine (CHEBI:34873) has role mutagen (CHEBI:25435) |
| N-nitrosodiethylamine (CHEBI:34873) is a nitrosamine (CHEBI:35803) |
| Incoming Relation(s) |
| N-ethyl-N-(2-hydroxyethyl)nitrosamine (CHEBI:141568) has functional parent N-nitrosodiethylamine (CHEBI:34873) |
| IUPAC Name |
|---|
| N-ethyl-N-nitrosoethanamine |
| Synonyms | Source |
|---|---|
| 1,1-diethyl-2-oxohydrazine | NIST Chemistry WebBook |
| DANA | NIST Chemistry WebBook |
| DEN | NIST Chemistry WebBook |
| Diethylnitrosamine | KEGG COMPOUND |
| diethylnitrosoamine | ChemIDplus |
| N,N-diethylnitrosamine | ChemIDplus |
| Citations |
|---|