EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10N2O2 |
| Net Charge | 0 |
| Average Mass | 118.136 |
| Monoisotopic Mass | 118.07423 |
| SMILES | CCN(CCO)N=O |
| InChI | InChI=1S/C4H10N2O2/c1-2-6(5-8)3-4-7/h7H,2-4H2,1H3 |
| InChIKey | HNQBPUIXFDQDRJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-ethyl-N-(2-hydroxyethyl)nitrosamine (CHEBI:141568) has functional parent N-nitrosodiethylamine (CHEBI:34873) |
| N-ethyl-N-(2-hydroxyethyl)nitrosamine (CHEBI:141568) has role carcinogenic agent (CHEBI:50903) |
| N-ethyl-N-(2-hydroxyethyl)nitrosamine (CHEBI:141568) is a nitrosamine (CHEBI:35803) |
| N-ethyl-N-(2-hydroxyethyl)nitrosamine (CHEBI:141568) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| N-ethyl-N-(2-hydroxyethyl)nitrous amide |
| Synonyms | Source |
|---|---|
| 2-(ethylnitrosamino)ethanol | ChEBI |
| Aethyl-aethanol-nitrosoamin | ChEBI |
| EHEN | ChEBI |
| N-ethyl-N-hydroxyethylnitrosamine | ChemIDplus |
| N-nitroso-N-ethyl-N-(2-hydroxyethyl)amine | ChemIDplus |
| N-nitrosoethyl-2-hydroxyethylamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:13147-25-6 | ChemIDplus |
| Citations |
|---|