EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N4OS |
| Net Charge | 0 |
| Average Mass | 214.294 |
| Monoisotopic Mass | 214.08883 |
| SMILES | CSc1nnc(C(C)(C)C)c(=O)n1N |
| InChI | InChI=1S/C8H14N4OS/c1-8(2,3)5-6(13)12(9)7(14-4)11-10-5/h9H2,1-4H3 |
| InChIKey | FOXFZRUHNHCZPX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metribuzin (CHEBI:34846) has role agrochemical (CHEBI:33286) |
| metribuzin (CHEBI:34846) has role environmental contaminant (CHEBI:78298) |
| metribuzin (CHEBI:34846) has role herbicide (CHEBI:24527) |
| metribuzin (CHEBI:34846) has role xenobiotic (CHEBI:35703) |
| metribuzin (CHEBI:34846) is a 1,2,4-triazines (CHEBI:39410) |
| metribuzin (CHEBI:34846) is a cyclic ketone (CHEBI:3992) |
| metribuzin (CHEBI:34846) is a organic sulfide (CHEBI:16385) |
| IUPAC Name |
|---|
| 4-amino-6-tert-butyl-3-(methylsulfanyl)-1,2,4-triazin-5(4H)-one |
| Synonym | Source |
|---|---|
| 4-amino-6-tert-butyl-4,5-dihydro-3-methylthio-1,2,4-triazin-5-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 469 | PPDB |
| C14332 | KEGG COMPOUND |
| metribuzin | Alan Wood's Pesticides |
| Metribuzin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:746650 | Reaxys |
| CAS:21087-64-9 | NIST Chemistry WebBook |
| CAS:21087-64-9 | KEGG COMPOUND |
| CAS:21087-64-9 | ChemIDplus |
| Citations |
|---|