EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O2 |
| Net Charge | 0 |
| Average Mass | 312.453 |
| Monoisotopic Mass | 312.20893 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@@]1(O)C#C |
| InChI | InChI=1S/C21H28O2/c1-4-21(23)12-9-18-16-6-5-14-13-15(22)7-10-19(14,2)17(16)8-11-20(18,21)3/h1,13,16-18,23H,5-12H2,2-3H3/t16-,17+,18+,19+,20+,21+/m1/s1 |
| InChIKey | CHNXZKVNWQUJIB-CEGNMAFCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. progestin A synthetic progestogen. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethisterone (CHEBI:34749) has functional parent testosterone (CHEBI:17347) |
| ethisterone (CHEBI:34749) has role androgen (CHEBI:50113) |
| ethisterone (CHEBI:34749) has role drug metabolite (CHEBI:49103) |
| ethisterone (CHEBI:34749) has role progestin (CHEBI:59826) |
| ethisterone (CHEBI:34749) is a 17β-hydroxy steroid (CHEBI:35343) |
| ethisterone (CHEBI:34749) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| ethisterone (CHEBI:34749) is a terminal acetylenic compound (CHEBI:73477) |
| ethisterone (CHEBI:34749) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (17α)-17-hydroxypregn-4-en-20-yn-3-one |
| INNs | Source |
|---|---|
| ethisterone | WHO MedNet |
| ethistérone | WHO MedNet |
| ethisteronum | WHO MedNet |
| etisterona | WHO MedNet |
| Synonyms | Source |
|---|---|
| 17-ethynyl-17β-hydroxyandrost-4-en-3-one | NIST Chemistry WebBook |
| 17-hydroxy-17α-pregn-4-en-20-yn-3-one | NIST Chemistry WebBook |
| 17α-ethinyltestosterone | ChemIDplus |
| 17α-ethynyl-17β-hydroxyandrost-4-en-3-one | NIST Chemistry WebBook |
| 17α-ethynyltestosterone | ChemIDplus |
| 17-β-hydroxy-17-α-ethynyl-4-androsten-3-one | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Lutocylol | ChemIDplus |
| Nugestoral | ChemIDplus |
| Ora-Lutin | ChemIDplus |
| Pranone | ChemIDplus |
| Prodroxan | NIST Chemistry WebBook |
| Produxan | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 1084 | DrugCentral |
| C14487 | KEGG COMPOUND |
| Ethisterone | Wikipedia |
| HMDB0060580 | HMDB |
| Citations |
|---|