EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO6 |
| Net Charge | 0 |
| Average Mass | 311.334 |
| Monoisotopic Mass | 311.13689 |
| SMILES | C/C(=C/C=C/[C@@H](C)C(=O)O)[C@H]1CN[C@H](C(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C15H21NO6/c1-8(4-3-5-9(2)14(19)20)11-7-16-13(15(21)22)10(11)6-12(17)18/h3-5,9-11,13,16H,6-7H2,1-2H3,(H,17,18)(H,19,20)(H,21,22)/b5-3+,8-4-/t9-,10+,11-,13+/m1/s1 |
| InChIKey | VZFRNCSOCOPNDB-AOKDLOFSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudo-nitzschia (ncbitaxon:41953) | - | PubMed (28817087) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Application: | neuromuscular agent A drug used for its actions on skeletal muscle. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| domoic acid (CHEBI:34727) has role algal metabolite (CHEBI:84735) |
| domoic acid (CHEBI:34727) has role hapten (CHEBI:59174) |
| domoic acid (CHEBI:34727) has role marine metabolite (CHEBI:76507) |
| domoic acid (CHEBI:34727) has role neuromuscular agent (CHEBI:51372) |
| domoic acid (CHEBI:34727) has role neurotoxin (CHEBI:50910) |
| domoic acid (CHEBI:34727) is a L-proline derivative (CHEBI:84186) |
| domoic acid (CHEBI:34727) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| domoic acid (CHEBI:34727) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| domoic acid (CHEBI:34727) is a tricarboxylic acid (CHEBI:27093) |
| domoic acid (CHEBI:34727) is conjugate acid of domoate(2−) (CHEBI:167470) |
| Incoming Relation(s) |
| domoate(2−) (CHEBI:167470) is conjugate base of domoic acid (CHEBI:34727) |
| IUPAC Name |
|---|
| (3S,4S)-4-[(2Z,4E,6R)-6-carboxyhepta-2,4-dien-2-yl]-3-(carboxymethyl)-L-proline |
| Synonym | Source |
|---|---|
| L-domoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00034487 | KNApSAcK |
| C13732 | KEGG COMPOUND |
| DB02852 | DrugBank |
| Domoic_acid | Wikipedia |
| DOQ | PDBeChem |
| FDB012146 | FooDB |
| HMDB0033939 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5126272 | Reaxys |
| CAS:14277-97-5 | ChemIDplus |
| CAS:14277-97-5 | KEGG COMPOUND |
| Citations |
|---|