EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO6 |
| Net Charge | 0 |
| Average Mass | 311.334 |
| Monoisotopic Mass | 311.13689 |
| SMILES | C/C(=C/C=C/[C@@H](C)C(=O)O)[C@H]1CN[C@H](C(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C15H21NO6/c1-8(4-3-5-9(2)14(19)20)11-7-16-13(15(21)22)10(11)6-12(17)18/h3-5,9-11,13,16H,6-7H2,1-2H3,(H,17,18)(H,19,20)(H,21,22)/b5-3+,8-4-/t9-,10+,11-,13+/m1/s1 |
| InChIKey | VZFRNCSOCOPNDB-AOKDLOFSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudo-nitzschia (ncbitaxon:41953) | - | PubMed (28817087) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. neurotoxin A poison that interferes with the functions of the nervous system. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | neuromuscular agent A drug used for its actions on skeletal muscle. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| domoic acid (CHEBI:34727) has role algal metabolite (CHEBI:84735) |
| domoic acid (CHEBI:34727) has role hapten (CHEBI:59174) |
| domoic acid (CHEBI:34727) has role marine metabolite (CHEBI:76507) |
| domoic acid (CHEBI:34727) has role neuromuscular agent (CHEBI:51372) |
| domoic acid (CHEBI:34727) has role neurotoxin (CHEBI:50910) |
| domoic acid (CHEBI:34727) is a L-proline derivative (CHEBI:84186) |
| domoic acid (CHEBI:34727) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| domoic acid (CHEBI:34727) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| domoic acid (CHEBI:34727) is a tricarboxylic acid (CHEBI:27093) |
| domoic acid (CHEBI:34727) is conjugate acid of domoate(2−) (CHEBI:167470) |
| Incoming Relation(s) |
| domoate(2−) (CHEBI:167470) is conjugate base of domoic acid (CHEBI:34727) |
| IUPAC Name |
|---|
| (3S,4S)-4-[(2Z,4E,6R)-6-carboxyhepta-2,4-dien-2-yl]-3-(carboxymethyl)-L-proline |
| Synonym | Source |
|---|---|
| L-domoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00034487 | KNApSAcK |
| C13732 | KEGG COMPOUND |
| DB02852 | DrugBank |
| Domoic_acid | Wikipedia |
| DOQ | PDBeChem |
| FDB012146 | FooDB |
| HMDB0033939 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5126272 | Reaxys |
| CAS:14277-97-5 | ChemIDplus |
| CAS:14277-97-5 | KEGG COMPOUND |
| Citations |
|---|